C21H24ClNO6S — CID 46814646
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 46814646) has the molecular formula C21H24ClNO6S and a molecular weight of 453.94 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 46814646 |
| Molecular Formula | C21H24ClNO6S |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H24ClNO6S/c1-13(19(24)14-6-9-16(22)10-7-14)29-20(25)15-8-11-17(28-5)18(12-15)30(26,27)23-21(2,3)4/h6-13,23H,1-5H3 |
| InChIKey | KPCVWMWPDOCKNZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |