C18H17ClO5 — CID 16560185
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,6-dimethoxybenzoate (PubChem CID 16560185) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,6-dimethoxybenzoate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 16560185 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OC(C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClO5/c1-11(17(20)12-7-9-13(19)10-8-12)24-18(21)16-14(22-2)5-4-6-15(16)23-3/h4-11H,1-3H3 |
| InChIKey | FKYQPLSZXQXPJN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |