C16H10Cl4O3 — CID 7170397
[(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate (PubChem CID 7170397) has the molecular formula C16H10Cl4O3 and a molecular weight of 392.07 g/mol. Its IUPAC name is [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate.
| Compound Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 7170397 |
| Molecular Formula | C16H10Cl4O3 |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1c(Cl)ccc(Cl)c1Cl)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Cl4O3/c1-8(15(21)9-2-4-10(17)5-3-9)23-16(22)13-11(18)6-7-12(19)14(13)20/h2-8H,1H3/t8-/m0/s1 |
| InChIKey | QVPAIANKRRNJPR-QMMMGPOBSA-N |
| XLogP | 5.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|