C19H15Cl3O3 — CID 7170377
[(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate (PubChem CID 7170377) has the molecular formula C19H15Cl3O3 and a molecular weight of 397.69 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate.
| Compound Name | [(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 7170377 |
| Molecular Formula | C19H15Cl3O3 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | [(2S)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1c(Cl)ccc(Cl)c1Cl)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H15Cl3O3/c1-10(18(23)13-6-5-11-3-2-4-12(11)9-13)25-19(24)16-14(20)7-8-15(21)17(16)22/h5-10H,2-4H2,1H3/t10-/m0/s1 |
| InChIKey | OUOJABULHCVRPU-JTQLQIEISA-N |
| XLogP | 5.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|