C19H17NO5 — CID 7834734
[(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 4-nitrobenzoate (PubChem CID 7834734) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7834734 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [(2R)-1-(2,3-dihydro-1H-inden-5-yl)-1-oxopropan-2-yl] 4-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H17NO5/c1-12(18(21)16-6-5-13-3-2-4-15(13)11-16)25-19(22)14-7-9-17(10-8-14)20(23)24/h5-12H,2-4H2,1H3/t12-/m1/s1 |
| InChIKey | VEAZTACMRGSFIU-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|