C16H11Cl3FNO3 — CID 7170432
[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate (PubChem CID 7170432) has the molecular formula C16H11Cl3FNO3 and a molecular weight of 390.63 g/mol. Its IUPAC name is [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate.
| Compound Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 7170432 |
| Molecular Formula | C16H11Cl3FNO3 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
| SMILES | C[C@@H](OC(=O)c1c(Cl)ccc(Cl)c1Cl)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H11Cl3FNO3/c1-8(15(22)21-10-4-2-9(20)3-5-10)24-16(23)13-11(17)6-7-12(18)14(13)19/h2-8H,1H3,(H,21,22)/t8-/m1/s1 |
| InChIKey | HIBLNKFUMUBJLZ-MRVPVSSYSA-N |
| XLogP | 4.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|