C17H12Cl3NO5 — CID 42897913
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate (PubChem CID 42897913) has the molecular formula C17H12Cl3NO5 and a molecular weight of 416.64 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 42897913 |
| Molecular Formula | C17H12Cl3NO5 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
| SMILES | CC(OC(=O)c1c(Cl)ccc(Cl)c1Cl)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H12Cl3NO5/c1-8(26-17(23)14-10(18)3-4-11(19)15(14)20)16(22)21-9-2-5-12-13(6-9)25-7-24-12/h2-6,8H,7H2,1H3,(H,21,22) |
| InChIKey | ZLUXNBOBOYZVIX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|