C17H14ClNO5 — CID 2629281
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-chlorobenzoate (PubChem CID 2629281) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-chlorobenzoate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2629281 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-chlorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14ClNO5/c1-10(24-17(21)11-2-4-12(18)5-3-11)16(20)19-13-6-7-14-15(8-13)23-9-22-14/h2-8,10H,9H2,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | AEEXCYJXUHTYJW-SNVBAGLBSA-N |
| XLogP | 3.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |