C18H15NO6 — CID 7669494
[(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-formylbenzoate (PubChem CID 7669494) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-formylbenzoate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-formylbenzoate |
|---|---|
| PubChem CID | 7669494 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-formylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(C=O)cc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO6/c1-11(25-18(22)13-4-2-12(9-20)3-5-13)17(21)19-14-6-7-15-16(8-14)24-10-23-15/h2-9,11H,10H2,1H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | AJGGHOFOIMLQEM-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|