C17H14N2O7 — CID 7504361
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitrobenzoate (PubChem CID 7504361) has the molecular formula C17H14N2O7 and a molecular weight of 358.31 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7504361 |
| Molecular Formula | C17H14N2O7 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N2O7/c1-10(26-17(21)11-2-5-13(6-3-11)19(22)23)16(20)18-12-4-7-14-15(8-12)25-9-24-14/h2-8,10H,9H2,1H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | OKFXZXHWTAMHII-SNVBAGLBSA-N |
| XLogP | 2.51 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|