C24H21N3O9S — CID 98393753
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate (PubChem CID 98393753) has the molecular formula C24H21N3O9S and a molecular weight of 527.51 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 98393753 |
| Molecular Formula | C24H21N3O9S |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C24H21N3O9S/c1-14-3-9-19(27(30)31)12-22(14)37(32,33)26-17-6-4-16(5-7-17)24(29)36-15(2)23(28)25-18-8-10-20-21(11-18)35-13-34-20/h3-12,15,26H,13H2,1-2H3,(H,25,28)/t15-/m1/s1 |
| InChIKey | XOWUJQPBNQGRJT-OAHLLOKOSA-N |
| XLogP | 3.62 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|