C17H13BrN2O7 — CID 18777937
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-bromo-3-nitrobenzoate (PubChem CID 18777937) has the molecular formula C17H13BrN2O7 and a molecular weight of 437.20 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-bromo-3-nitrobenzoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 18777937 |
| Molecular Formula | C17H13BrN2O7 |
| Molecular Weight | 437.20 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-bromo-3-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc(Br)c([N+](=O)[O-])c1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13BrN2O7/c1-9(16(21)19-11-3-5-14-15(7-11)26-8-25-14)27-17(22)10-2-4-12(18)13(6-10)20(23)24/h2-7,9H,8H2,1H3,(H,19,21) |
| InChIKey | DACULAZQELIPLB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|