C18H15ClN2O7 — CID 7865891
[(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate (PubChem CID 7865891) has the molecular formula C18H15ClN2O7 and a molecular weight of 406.78 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate.
| Compound Name | [(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7865891 |
| Molecular Formula | C18H15ClN2O7 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H15ClN2O7/c1-10(28-18(23)11-2-4-13(19)14(8-11)21(24)25)17(22)20-12-3-5-15-16(9-12)27-7-6-26-15/h2-5,8-10H,6-7H2,1H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | WNCYMIOETUFTQY-JTQLQIEISA-N |
| XLogP | 3.20 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|