C13H15BrN2O5 — CID 9459187
[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 4-bromo-3-nitrobenzoate (PubChem CID 9459187) has the molecular formula C13H15BrN2O5 and a molecular weight of 359.18 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 4-bromo-3-nitrobenzoate.
| Compound Name | [(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 9459187 |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | [(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 4-bromo-3-nitrobenzoate |
| SMILES | CC(C)NC(=O)[C@H](C)OC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15BrN2O5/c1-7(2)15-12(17)8(3)21-13(18)9-4-5-10(14)11(6-9)16(19)20/h4-8H,1-3H3,(H,15,17)/t8-/m0/s1 |
| InChIKey | FLTUYUPHKRXCEN-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|