C14H17BrN2O5 — CID 7725919
[2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate (PubChem CID 7725919) has the molecular formula C14H17BrN2O5 and a molecular weight of 373.20 g/mol. Its IUPAC name is [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate.
| Compound Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 7725919 |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
| SMILES | CC(C)[C@H](C)NC(=O)COC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17BrN2O5/c1-8(2)9(3)16-13(18)7-22-14(19)10-4-5-11(15)12(6-10)17(20)21/h4-6,8-9H,7H2,1-3H3,(H,16,18)/t9-/m0/s1 |
| InChIKey | XYJYCWBEHFFKAN-VIFPVBQESA-N |
| XLogP | 2.67 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|