C15H13N3O7 — CID 9454027
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitro-1H-pyrrole-2-carboxylate (PubChem CID 9454027) has the molecular formula C15H13N3O7 and a molecular weight of 347.28 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitro-1H-pyrrole-2-carboxylate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9454027 |
| Molecular Formula | C15H13N3O7 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 4-nitro-1H-pyrrole-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc([N+](=O)[O-])c[nH]1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13N3O7/c1-8(25-15(20)11-5-10(6-16-11)18(21)22)14(19)17-9-2-3-12-13(4-9)24-7-23-12/h2-6,8,16H,7H2,1H3,(H,17,19)/t8-/m1/s1 |
| InChIKey | QHZSCRRQZATSPH-MRVPVSSYSA-N |
| XLogP | 1.84 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|