C16H13Cl2NO4 — CID 45147837
2-(1,3-benzodioxol-5-yloxy)-N-(3,4-dichlorophenyl)propanamide (PubChem CID 45147837) has the molecular formula C16H13Cl2NO4 and a molecular weight of 354.19 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-(3,4-dichlorophenyl)propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 45147837 |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-(3,4-dichlorophenyl)propanamide |
| SMILES | CC(Oc1ccc2c(c1)OCO2)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO4/c1-9(16(20)19-10-2-4-12(17)13(18)6-10)23-11-3-5-14-15(7-11)22-8-21-14/h2-7,9H,8H2,1H3,(H,19,20) |
| InChIKey | LSJOVPIGIWCRSL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |