C16H11Cl4NO3 — CID 46617014
[1-(2-chloroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate (PubChem CID 46617014) has the molecular formula C16H11Cl4NO3 and a molecular weight of 407.08 g/mol. Its IUPAC name is [1-(2-chloroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate.
| Compound Name | [1-(2-chloroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 46617014 |
| Molecular Formula | C16H11Cl4NO3 |
| Molecular Weight | 407.08 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | [1-(2-chloroanilino)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
| SMILES | CC(OC(=O)c1c(Cl)ccc(Cl)c1Cl)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H11Cl4NO3/c1-8(15(22)21-12-5-3-2-4-9(12)17)24-16(23)13-10(18)6-7-11(19)14(13)20/h2-8H,1H3,(H,21,22) |
| InChIKey | IVRFKNLZXXCVON-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.08 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|