C19H30N2O6S — CID 46685651
[1-(tert-butylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 46685651) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 46685651 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)NC(C)(C)C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H30N2O6S/c1-12(16(22)20-18(2,3)4)27-17(23)13-9-10-14(26-8)15(11-13)28(24,25)21-19(5,6)7/h9-12,21H,1-8H3,(H,20,22) |
| InChIKey | LMBHSCBLDDURJS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |