C20H22FNO5S — CID 7975428
[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate (PubChem CID 7975428) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7975428 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(S(=O)(=O)NC(C)(C)C)c1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO5S/c1-13(18(23)14-8-10-16(21)11-9-14)27-19(24)15-6-5-7-17(12-15)28(25,26)22-20(2,3)4/h5-13,22H,1-4H3/t13-/m0/s1 |
| InChIKey | VQLAUNROJOBNMA-ZDUSSCGKSA-N |
| XLogP | 3.33 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |