C24H21FN2O6S — CID 43004259
[1-(4-acetamidophenyl)-1-oxopropan-2-yl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 43004259) has the molecular formula C24H21FN2O6S and a molecular weight of 484.51 g/mol. Its IUPAC name is [1-(4-acetamidophenyl)-1-oxopropan-2-yl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [1-(4-acetamidophenyl)-1-oxopropan-2-yl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43004259 |
| Molecular Formula | C24H21FN2O6S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [1-(4-acetamidophenyl)-1-oxopropan-2-yl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)C(C)OC(=O)c2cccc(S(=O)(=O)Nc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C24H21FN2O6S/c1-15(23(29)17-6-10-20(11-7-17)26-16(2)28)33-24(30)18-4-3-5-22(14-18)34(31,32)27-21-12-8-19(25)9-13-21/h3-15,27H,1-2H3,(H,26,28) |
| InChIKey | PLZMJVNNXIQSAY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |