C17H16ClNO6S — CID 8644524
[(2S)-1-methoxy-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfamoyl]benzoate (PubChem CID 8644524) has the molecular formula C17H16ClNO6S and a molecular weight of 397.84 g/mol. Its IUPAC name is [(2S)-1-methoxy-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-methoxy-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8644524 |
| Molecular Formula | C17H16ClNO6S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | [(2S)-1-methoxy-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfamoyl]benzoate |
| SMILES | COC(=O)[C@H](C)OC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H16ClNO6S/c1-11(16(20)24-2)25-17(21)12-4-3-5-15(10-12)26(22,23)19-14-8-6-13(18)7-9-14/h3-11,19H,1-2H3/t11-/m0/s1 |
| InChIKey | LRIPCYSXJSFGOP-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |