C18H18ClN3O6S — CID 43001109
[1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate (PubChem CID 43001109) has the molecular formula C18H18ClN3O6S and a molecular weight of 439.88 g/mol. Its IUPAC name is [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43001109 |
| Molecular Formula | C18H18ClN3O6S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H18ClN3O6S/c1-11(16(23)21-18(25)20-2)28-17(24)12-5-3-8-15(9-12)29(26,27)22-14-7-4-6-13(19)10-14/h3-11,22H,1-2H3,(H2,20,21,23,25) |
| InChIKey | IFUSJAQLVVXUAM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |