C17H16Cl2N2O5S — CID 2605664
[(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate (PubChem CID 2605664) has the molecular formula C17H16Cl2N2O5S and a molecular weight of 431.30 g/mol. Its IUPAC name is [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2605664 |
| Molecular Formula | C17H16Cl2N2O5S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)O[C@H](C)C(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O5S/c1-10(16(22)21-15-7-6-12(18)9-14(15)19)26-17(23)11-4-3-5-13(8-11)27(24,25)20-2/h3-10,20H,1-2H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | ILCPPXMOQCHPOI-SNVBAGLBSA-N |
| XLogP | 3.09 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |