C19H16ClFN2O5S — CID 55449899
[1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 55449899) has the molecular formula C19H16ClFN2O5S and a molecular weight of 438.86 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55449899 |
| Molecular Formula | C19H16ClFN2O5S |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)OC(C)C(=O)Nc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O5S/c1-3-9-22-29(26,27)15-6-4-5-13(10-15)19(25)28-12(2)18(24)23-17-8-7-14(21)11-16(17)20/h1,4-8,10-12,22H,9H2,2H3,(H,23,24) |
| InChIKey | QOUFODIYNVOUGA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|