C17H13ClF3NO5S — CID 16513270
[1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 16513270) has the molecular formula C17H13ClF3NO5S and a molecular weight of 435.81 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 16513270 |
| Molecular Formula | C17H13ClF3NO5S |
| Molecular Weight | 435.81 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H13ClF3NO5S/c1-9(15(23)22-14-7-4-11(19)8-13(14)18)27-16(24)10-2-5-12(6-3-10)28(25,26)17(20)21/h2-9,17H,1H3,(H,22,23) |
| InChIKey | ADIJNUROYWFKRP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |