C17H14ClFN2O5 — CID 2630205
[(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate (PubChem CID 2630205) has the molecular formula C17H14ClFN2O5 and a molecular weight of 380.76 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate.
| Compound Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 2630205 |
| Molecular Formula | C17H14ClFN2O5 |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)O[C@@H](C)C(=O)Nc2ccc(F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClFN2O5/c1-9-7-11(3-6-15(9)21(24)25)17(23)26-10(2)16(22)20-14-5-4-12(19)8-13(14)18/h3-8,10H,1-2H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | AMHKBZMSOVKMTE-JTQLQIEISA-N |
| XLogP | 3.88 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|