C20H22ClN3O6S — CID 24587838
[1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate (PubChem CID 24587838) has the molecular formula C20H22ClN3O6S and a molecular weight of 467.93 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 24587838 |
| Molecular Formula | C20H22ClN3O6S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 3-[(3-chlorophenyl)sulfamoyl]benzoate |
| SMILES | CC(C)NC(=O)NC(=O)C(C)OC(=O)c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H22ClN3O6S/c1-12(2)22-20(27)23-18(25)13(3)30-19(26)14-6-4-9-17(10-14)31(28,29)24-16-8-5-7-15(21)11-16/h4-13,24H,1-3H3,(H2,22,23,25,27) |
| InChIKey | RPQJNFKWRIASHW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |