C24H31NO5S — CID 2505857
[(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate (PubChem CID 2505857) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is [(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2505857 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C24H31NO5S/c1-7-25(8-2)31(28,29)21-11-9-10-19(16-21)23(27)30-17(3)22(26)18-12-14-20(15-13-18)24(4,5)6/h9-17H,7-8H2,1-6H3/t17-/m0/s1 |
| InChIKey | CRHHWBVABJASLG-KRWDZBQOSA-N |
| XLogP | 4.44 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |