C16H22N2O7S — CID 8988487
[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate (PubChem CID 8988487) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8988487 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(tert-butylsulfamoyl)benzoate |
| SMILES | COC(=O)NC(=O)[C@@H](C)OC(=O)c1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C16H22N2O7S/c1-10(13(19)17-15(21)24-5)25-14(20)11-7-6-8-12(9-11)26(22,23)18-16(2,3)4/h6-10,18H,1-5H3,(H,17,19,21)/t10-/m1/s1 |
| InChIKey | HZJOQNZKXAVXEP-SNVBAGLBSA-N |
| XLogP | 1.19 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |