C14H17NO7S — CID 8974519
[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 8974519) has the molecular formula C14H17NO7S and a molecular weight of 343.36 g/mol. Its IUPAC name is [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8974519 |
| Molecular Formula | C14H17NO7S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | COC(=O)NC(=O)[C@@H](C)OC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H17NO7S/c1-9(12(16)15-14(18)21-2)22-13(17)11-6-4-5-10(7-11)8-23(3,19)20/h4-7,9H,8H2,1-3H3,(H,15,16,18)/t9-/m1/s1 |
| InChIKey | JQOJJILAZPQSDX-SECBINFHSA-N |
| XLogP | 0.66 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |