C20H23NO6S — CID 8974656
[(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 8974656) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8974656 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](C)OC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H23NO6S/c1-13-8-9-18(26-3)17(10-13)21-19(22)14(2)27-20(23)16-7-5-6-15(11-16)12-28(4,24)25/h5-11,14H,12H2,1-4H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | UECSZRACPOHSCV-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |