C15H21NO6S — CID 8974565
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 8974565) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8974565 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H21NO6S/c1-11(14(17)16-7-8-21-2)22-15(18)13-6-4-5-12(9-13)10-23(3,19)20/h4-6,9,11H,7-8,10H2,1-3H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | DPWKJSICKVSTGP-NSHDSACASA-N |
| XLogP | 0.54 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|