C15H21NO5 — CID 8998609
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate (PubChem CID 8998609) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 8998609 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)c1cccc(COC)c1 |
| InChI | InChI=1S/C15H21NO5/c1-11(14(17)16-7-8-19-2)21-15(18)13-6-4-5-12(9-13)10-20-3/h4-6,9,11H,7-8,10H2,1-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | PMOZQYUQMUIWJE-LLVKDONJSA-N |
| XLogP | 1.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|