C14H19NO4 — CID 55392843
[1-(dimethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate (PubChem CID 55392843) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is [1-(dimethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate.
| Compound Name | [1-(dimethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 55392843 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [1-(dimethylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)benzoate |
| SMILES | COCc1cccc(C(=O)OC(C)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H19NO4/c1-10(13(16)15(2)3)19-14(17)12-7-5-6-11(8-12)9-18-4/h5-8,10H,9H2,1-4H3 |
| InChIKey | NNNBZAFORCRFEO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |