C18H19N3O6S — CID 8940397
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate (PubChem CID 8940397) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8940397 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(=O)NNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N3O6S/c1-12(16(22)20-21-17(23)13-7-4-3-5-8-13)27-18(24)14-9-6-10-15(11-14)28(25,26)19-2/h3-12,19H,1-2H3,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | XKLJJVDVTFKTBO-LBPRGKRZSA-N |
| XLogP | 0.60 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|