C21H23NO5S — CID 43025432
[1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 43025432) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is [1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 43025432 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CCc1ccc(C(=O)C(C)OC(=O)c2cccc(S(=O)(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-3-15-7-9-16(10-8-15)20(23)14(2)27-21(24)17-5-4-6-19(13-17)28(25,26)22-18-11-12-18/h4-10,13-14,18,22H,3,11-12H2,1-2H3 |
| InChIKey | OQGFBBFXYSLRLJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |