C11H15NO2S — CID 70914015
N-cyclopropyl-3-ethylbenzenesulfonamide (PubChem CID 70914015) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-cyclopropyl-3-ethylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-3-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 70914015 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-cyclopropyl-3-ethylbenzenesulfonamide |
| SMILES | CCc1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C11H15NO2S/c1-2-9-4-3-5-11(8-9)15(13,14)12-10-6-7-10/h3-5,8,10,12H,2,6-7H2,1H3 |
| InChIKey | LMKPRQPFIUMIRK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |