C15H23NO3S — CID 71691365
N-cyclopentyl-3-(propan-2-yloxymethyl)benzenesulfonamide (PubChem CID 71691365) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-cyclopentyl-3-(propan-2-yloxymethyl)benzenesulfonamide.
| Compound Name | N-cyclopentyl-3-(propan-2-yloxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71691365 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-cyclopentyl-3-(propan-2-yloxymethyl)benzenesulfonamide |
| SMILES | CC(C)OCc1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-12(2)19-11-13-6-5-9-15(10-13)20(17,18)16-14-7-3-4-8-14/h5-6,9-10,12,14,16H,3-4,7-8,11H2,1-2H3 |
| InChIKey | AQOOZGXNARNMFG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |