C15H23NO3S — CID 71691379
1-[3-(propan-2-yloxymethyl)phenyl]sulfonylpiperidine (PubChem CID 71691379) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-[3-(propan-2-yloxymethyl)phenyl]sulfonylpiperidine.
| Compound Name | 1-[3-(propan-2-yloxymethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 71691379 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[3-(propan-2-yloxymethyl)phenyl]sulfonylpiperidine |
| SMILES | CC(C)OCc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-13(2)19-12-14-7-6-8-15(11-14)20(17,18)16-9-4-3-5-10-16/h6-8,11,13H,3-5,9-10,12H2,1-2H3 |
| InChIKey | ZBLZVJBIEOKOHX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |