C24H33NO4S2 — CID 158174529
N-cyclohexyl-3-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzenesulfonamide (PubChem CID 158174529) has the molecular formula C24H33NO4S2 and a molecular weight of 463.67 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | N-cyclohexyl-3-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 158174529 |
| Molecular Formula | C24H33NO4S2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-cyclohexyl-3-[2-[4-(propan-2-ylsulfonylmethyl)phenyl]ethyl]benzenesulfonamide |
| SMILES | CC(C)S(=O)(=O)Cc1ccc(CCc2cccc(S(=O)(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C24H33NO4S2/c1-19(2)30(26,27)18-22-15-12-20(13-16-22)11-14-21-7-6-10-24(17-21)31(28,29)25-23-8-4-3-5-9-23/h6-7,10,12-13,15-17,19,23,25H,3-5,8-9,11,14,18H2,1-2H3 |
| InChIKey | WSGIYJSQQHRLAN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |