C22H31N3O4S2 — CID 70939182
N-cyclohexyl-3-[[4-(propan-2-ylsulfonylamino)phenyl]methylamino]benzenesulfonamide (PubChem CID 70939182) has the molecular formula C22H31N3O4S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-cyclohexyl-3-[[4-(propan-2-ylsulfonylamino)phenyl]methylamino]benzenesulfonamide.
| Compound Name | N-cyclohexyl-3-[[4-(propan-2-ylsulfonylamino)phenyl]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 70939182 |
| Molecular Formula | C22H31N3O4S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-cyclohexyl-3-[[4-(propan-2-ylsulfonylamino)phenyl]methylamino]benzenesulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1ccc(CNc2cccc(S(=O)(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H31N3O4S2/c1-17(2)30(26,27)24-20-13-11-18(12-14-20)16-23-21-9-6-10-22(15-21)31(28,29)25-19-7-4-3-5-8-19/h6,9-15,17,19,23-25H,3-5,7-8,16H2,1-2H3 |
| InChIKey | GJRJZVNWKQAUJQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |