C16H18F2N2O2S — CID 70939016
N-[4-[(3,4-difluoroanilino)methyl]phenyl]propane-2-sulfonamide (PubChem CID 70939016) has the molecular formula C16H18F2N2O2S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[4-[(3,4-difluoroanilino)methyl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-[(3,4-difluoroanilino)methyl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939016 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[4-[(3,4-difluoroanilino)methyl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1ccc(CNc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H18F2N2O2S/c1-11(2)23(21,22)20-13-5-3-12(4-6-13)10-19-14-7-8-15(17)16(18)9-14/h3-9,11,19-20H,10H2,1-2H3 |
| InChIKey | GGQVEFUINTULFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |