C13H11F2N — CID 21321396
N-benzyl-3,4-difluoroaniline (PubChem CID 21321396) has the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. Its IUPAC name is N-benzyl-3,4-difluoroaniline.
| Compound Name | N-benzyl-3,4-difluoroaniline |
|---|---|
| PubChem CID | 21321396 |
| Molecular Formula | C13H11F2N |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-benzyl-3,4-difluoroaniline |
| SMILES | Fc1ccc(NCc2ccccc2)cc1F |
| InChI | InChI=1S/C13H11F2N/c14-12-7-6-11(8-13(12)15)16-9-10-4-2-1-3-5-10/h1-8,16H,9H2 |
| InChIKey | ZBWNJUTVRIREEA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |