C14H13F2NS — CID 29267990
3,4-difluoro-N-[(4-methylsulfanylphenyl)methyl]aniline (PubChem CID 29267990) has the molecular formula C14H13F2NS and a molecular weight of 265.33 g/mol. Its IUPAC name is 3,4-difluoro-N-[(4-methylsulfanylphenyl)methyl]aniline.
| Compound Name | 3,4-difluoro-N-[(4-methylsulfanylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 29267990 |
| Molecular Formula | C14H13F2NS |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3,4-difluoro-N-[(4-methylsulfanylphenyl)methyl]aniline |
| SMILES | CSc1ccc(CNc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H13F2NS/c1-18-12-5-2-10(3-6-12)9-17-11-4-7-13(15)14(16)8-11/h2-8,17H,9H2,1H3 |
| InChIKey | WUYNZQBGUDZAAK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |