N-benzyl-4-chloroaniline chloride

C13H12Cl2N- — CID 45109713

IUPACN-benzyl-4-chloroaniline chloride
SMILESClc1ccc(NCc2ccccc2)cc1.[Cl-]
InChIInChI=1S/C13H12ClN.ClH/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;/h1-9,15H,10H2;1H/p-1
InChIKeyLFOCALYQBKUZFT-UHFFFAOYSA-M
MW253.15 g/mol
LogP0.96
Rot. Bonds3

About N-benzyl-4-chloroaniline chloride

N-benzyl-4-chloroaniline chloride (PubChem CID 45109713) has the molecular formula C13H12Cl2N- and a molecular weight of 253.15 g/mol. Its IUPAC name is N-benzyl-4-chloroaniline chloride.

Molecular Properties

Compound NameN-benzyl-4-chloroaniline chloride
PubChem CID45109713
Molecular FormulaC13H12Cl2N-
Molecular Weight253.15 g/mol
Exact Mass252.04
IUPAC NameN-benzyl-4-chloroaniline chloride
SMILESClc1ccc(NCc2ccccc2)cc1.[Cl-]
InChIInChI=1S/C13H12ClN.ClH/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;/h1-9,15H,10H2;1H/p-1
InChIKeyLFOCALYQBKUZFT-UHFFFAOYSA-M
XLogP0.96
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.15
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze N-benzyl-4-chloroaniline chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-benzyl-4-chloroaniline chloride?
The IUPAC name of N-benzyl-4-chloroaniline chloride (CID 45109713) is N-benzyl-4-chloroaniline chloride.
What is the SMILES notation for N-benzyl-4-chloroaniline chloride?
The canonical SMILES for N-benzyl-4-chloroaniline chloride is Clc1ccc(NCc2ccccc2)cc1.[Cl-].
What is the InChIKey of N-benzyl-4-chloroaniline chloride?
The InChIKey is LFOCALYQBKUZFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H12ClN.ClH/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;/h1-9,15H,10H2;1H/p-1.
What are the key properties of N-benzyl-4-chloroaniline chloride?
N-benzyl-4-chloroaniline chloride has a molecular weight of 253.15 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-chloroaniline chloride is sourced from PubChem (CID 45109713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).