About N-benzyl-4-chloroaniline chloride
N-benzyl-4-chloroaniline chloride (PubChem CID 45109713) has the molecular formula C13H12Cl2N-
and a molecular weight of 253.15 g/mol. Its IUPAC name is N-benzyl-4-chloroaniline chloride.
Molecular Properties
| Compound Name | N-benzyl-4-chloroaniline chloride |
| PubChem CID | 45109713 |
| Molecular Formula | C13H12Cl2N- |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-benzyl-4-chloroaniline chloride |
| SMILES | Clc1ccc(NCc2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C13H12ClN.ClH/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;/h1-9,15H,10H2;1H/p-1 |
| InChIKey | LFOCALYQBKUZFT-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-4-chloroaniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-chloroaniline chloride?
The IUPAC name of N-benzyl-4-chloroaniline chloride (CID 45109713) is N-benzyl-4-chloroaniline chloride.
What is the SMILES notation for N-benzyl-4-chloroaniline chloride?
The canonical SMILES for N-benzyl-4-chloroaniline chloride is Clc1ccc(NCc2ccccc2)cc1.[Cl-].
What is the InChIKey of N-benzyl-4-chloroaniline chloride?
The InChIKey is LFOCALYQBKUZFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H12ClN.ClH/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;/h1-9,15H,10H2;1H/p-1.
What are the key properties of N-benzyl-4-chloroaniline chloride?
N-benzyl-4-chloroaniline chloride has a molecular weight of 253.15 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-chloroaniline chloride is sourced from PubChem (CID 45109713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).