C21H19ClN2O2 — CID 25155891
2-[4-[(4-chlorophenyl)methylamino]phenyl]-N-hydroxy-2-phenylacetamide (PubChem CID 25155891) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methylamino]phenyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)methylamino]phenyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 25155891 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methylamino]phenyl]-N-hydroxy-2-phenylacetamide |
| SMILES | O=C(NO)C(c1ccccc1)c1ccc(NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H19ClN2O2/c22-18-10-6-15(7-11-18)14-23-19-12-8-17(9-13-19)20(21(25)24-26)16-4-2-1-3-5-16/h1-13,20,23,26H,14H2,(H,24,25) |
| InChIKey | GWYOPJLLJHKJTL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|