C21H17Cl2NO — CID 1144143
N-benzyl-2,2-bis(4-chlorophenyl)acetamide (PubChem CID 1144143) has the molecular formula C21H17Cl2NO and a molecular weight of 370.28 g/mol. Its IUPAC name is N-benzyl-2,2-bis(4-chlorophenyl)acetamide.
| Compound Name | N-benzyl-2,2-bis(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 1144143 |
| Molecular Formula | C21H17Cl2NO |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-benzyl-2,2-bis(4-chlorophenyl)acetamide |
| SMILES | O=C(NCc1ccccc1)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17Cl2NO/c22-18-10-6-16(7-11-18)20(17-8-12-19(23)13-9-17)21(25)24-14-15-4-2-1-3-5-15/h1-13,20H,14H2,(H,24,25) |
| InChIKey | CQQZFQKNODFRIL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |