C25H27NO — CID 2225639
N-[(4-tert-butylphenyl)methyl]-2,2-diphenylacetamide (PubChem CID 2225639) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2,2-diphenylacetamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2225639 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2,2-diphenylacetamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO/c1-25(2,3)22-16-14-19(15-17-22)18-26-24(27)23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,23H,18H2,1-3H3,(H,26,27) |
| InChIKey | BBXWCQFLUCPMBP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |