C17H19F3N2O2S — CID 70939828
N-[4-[[4-(trifluoromethyl)anilino]methyl]phenyl]propane-2-sulfonamide (PubChem CID 70939828) has the molecular formula C17H19F3N2O2S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[4-[[4-(trifluoromethyl)anilino]methyl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[4-(trifluoromethyl)anilino]methyl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939828 |
| Molecular Formula | C17H19F3N2O2S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[4-[[4-(trifluoromethyl)anilino]methyl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1ccc(CNc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H19F3N2O2S/c1-12(2)25(23,24)22-16-7-3-13(4-8-16)11-21-15-9-5-14(6-10-15)17(18,19)20/h3-10,12,21-22H,11H2,1-2H3 |
| InChIKey | LBIDEQHJSRCFGV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |